![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| About the hard winter wheat regional quality reports....html | 2025-06-24 17:02 | 2.6K | |
| NRPN physical data.html | 2025-06-24 17:02 | 2.8K | |
| WPRPN physical data.html | 2025-06-24 17:02 | 2.8K | |
| NRPN hardness data.html | 2025-06-24 17:02 | 3.5K | |
| SRPN physical data.html | 2025-06-24 17:02 | 3.5K | |
| WPRPN hardness data.html | 2025-06-24 17:02 | 3.5K | |
| NRPN chemical and mixograph data.html | 2025-06-24 17:02 | 3.5K | |
| WPRPN chemical and mixograph data.html | 2025-06-24 17:02 | 3.5K | |
| NRPN breadmaking properties.html | 2025-06-24 17:02 | 3.5K | |
| WPRPN breadmaking properties.html | 2025-06-24 17:02 | 3.5K | |
| SRPN chemical and mixograph data.html | 2025-06-24 17:02 | 4.3K | |
| SRPN hardness data.html | 2025-06-24 17:02 | 4.3K | |
| SRPN breadmaking properties.html | 2025-06-24 17:02 | 4.4K | |