![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| NRPN breadmaking properties.html | 2025-06-24 17:07 | 3.7K | |
| NRPN chemical and mixograph data.html | 2025-06-24 17:07 | 3.6K | |
| NRPN hardness data.html | 2025-06-24 17:07 | 3.6K | |
| NRPN physical data.html | 2025-06-24 17:07 | 2.9K | |
| SRPN breadmaking properties.html | 2025-06-24 17:07 | 4.4K | |
| SRPN chemical and mixograph data.html | 2025-06-24 17:07 | 4.4K | |
| SRPN hardness data.html | 2025-06-24 17:07 | 4.4K | |
| SRPN physical data.html | 2025-06-24 17:07 | 3.5K | |
| WPRPN breadmaking properties.html | 2025-06-24 17:07 | 3.3K | |
| WPRPN chemical and mixograph data.html | 2025-06-24 17:07 | 3.3K | |
| WPRPN hardness data.html | 2025-06-24 17:07 | 3.2K | |